Difucol
|
| Names
|
Preferred IUPAC name
[1,1′-Biphenyl]-2,2′,4,4′,6,6′-hexol
|
| Identifiers
|
|
|
|
|
|
|
| ChemSpider
|
|
|
|
|
|
|
|
InChI=1S/C12H10O6/c13-5-1-7(15)11(8(16)2-5)12-9(17)3-6(14)4-10(12)18/h1-4,13-18H Key: PHDPNHJFOMABOA-UHFFFAOYSA-N InChI=1/C12H10O6/c13-5-1-7(15)11(8(16)2-5)12-9(17)3-6(14)4-10(12)18/h1-4,13-18H Key: PHDPNHJFOMABOA-UHFFFAOYAY
|
Oc1cc(O)cc(O)c1-c2c(O)cc(O)cc2O
|
| Properties
|
|
|
C12H10O6
|
| Molar mass
|
250.20 g/mol
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references
|
Difucol is a phlorotannin found in the brown algae Analipus japonicus and Cystophora retroflexa.[1]
References
- ^ PubChem. "Difucol". pubchem.ncbi.nlm.nih.gov. Retrieved 2022-11-15.
|
|---|
| Monomer | |
|---|
| Fucols | |
|---|
| Phlorethols |
- Diphlorethol and diphlorethol A
- Triphloroethol A
- Tetraphlorethol A, B, C and E
- Pentaphlorethol-B
- Hexaphlorethol-A
|
|---|
| Fucophlorethols |
- Fucophlorethol A and B
- Fucodiphlorethol A, D and G
- Fucotriphlorethol-B, G and H
- Fucotetraphlorethol-B, J and K
- Fucopentaphlorethol-E
- Bisfucotriphlorethol-A
- Bisfucotetraphlorethol-A
- Bisfucopentaphlorethol-A and B
- Bisfucoheptaphlorethol-A
- Difucophlorethol-A
- Difucofucotriphlorethol-A and B
- Difucofucotetraphlorethol-A
- Terfucopentaphlorethol-A
- Terfucohexaphlorethol-A and B
- Terfucoheptaphlorethol-A
|
|---|
| Fuhalols | |
|---|
| Isofuhalols | |
|---|
| Eckols | |
|---|
| Halogenated phlorotannins | Bromotriphlorethol A1 |
|---|
 Category |